C11H12N2O6 — CID 139703889
5-cyclopentyloxy-2,4-dinitrophenol (PubChem CID 139703889) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 5-cyclopentyloxy-2,4-dinitrophenol.
| Compound Name | 5-cyclopentyloxy-2,4-dinitrophenol |
|---|---|
| PubChem CID | 139703889 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-cyclopentyloxy-2,4-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(OC2CCCC2)cc1O |
| InChI | InChI=1S/C11H12N2O6/c14-10-6-11(19-7-3-1-2-4-7)9(13(17)18)5-8(10)12(15)16/h5-7,14H,1-4H2 |
| InChIKey | MTRRMNXDWOWCMD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|