C11H14N2O3 — CID 43365795
3-[2-(4-aminophenoxy)ethyl]-1,3-oxazolidin-2-one (PubChem CID 43365795) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-[2-(4-aminophenoxy)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(4-aminophenoxy)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 43365795 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-[2-(4-aminophenoxy)ethyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1ccc(OCCN2CCOC2=O)cc1 |
| InChI | InChI=1S/C11H14N2O3/c12-9-1-3-10(4-2-9)15-7-5-13-6-8-16-11(13)14/h1-4H,5-8,12H2 |
| InChIKey | SXYVWCZHGPSBLY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|