C12H16N2O3 — CID 43365793
3-[3-(3-aminophenoxy)propyl]-1,3-oxazolidin-2-one (PubChem CID 43365793) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[3-(3-aminophenoxy)propyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(3-aminophenoxy)propyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 43365793 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[3-(3-aminophenoxy)propyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1cccc(OCCCN2CCOC2=O)c1 |
| InChI | InChI=1S/C12H16N2O3/c13-10-3-1-4-11(9-10)16-7-2-5-14-6-8-17-12(14)15/h1,3-4,9H,2,5-8,13H2 |
| InChIKey | OCDORTNAHYHNFR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|