C10H10ClNO3 — CID 140971353
3-[(3-chlorophenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 140971353) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 3-[(3-chlorophenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3-chlorophenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140971353 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-[(3-chlorophenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1COc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H10ClNO3/c11-8-2-1-3-9(6-8)15-7-12-4-5-14-10(12)13/h1-3,6H,4-5,7H2 |
| InChIKey | OBWYKKPIBLCZKE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |