C15H16ClN3O2 — CID 4863104
[1-[(3-chlorophenoxy)methyl]pyrazol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 4863104) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is [1-[(3-chlorophenoxy)methyl]pyrazol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[(3-chlorophenoxy)methyl]pyrazol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 4863104 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [1-[(3-chlorophenoxy)methyl]pyrazol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccn(COc2cccc(Cl)c2)n1)N1CCCC1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-4-3-5-13(10-12)21-11-19-9-6-14(17-19)15(20)18-7-1-2-8-18/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | ZZIFDSLCLCBUFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |