C12H14N2O3S — CID 43365706
3-[3-(3-aminophenoxy)propyl]-1,3-thiazolidine-2,4-dione (PubChem CID 43365706) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-[3-(3-aminophenoxy)propyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-(3-aminophenoxy)propyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 43365706 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-[3-(3-aminophenoxy)propyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Nc1cccc(OCCCN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C12H14N2O3S/c13-9-3-1-4-10(7-9)17-6-2-5-14-11(15)8-18-12(14)16/h1,3-4,7H,2,5-6,8,13H2 |
| InChIKey | BFSWGVZUHXPYAH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|