C19H22N2O2 — CID 84758464
1-[3-(3-aminophenoxy)propyl]-5-ethyl-3H-indol-2-one (PubChem CID 84758464) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[3-(3-aminophenoxy)propyl]-5-ethyl-3H-indol-2-one.
| Compound Name | 1-[3-(3-aminophenoxy)propyl]-5-ethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 84758464 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[3-(3-aminophenoxy)propyl]-5-ethyl-3H-indol-2-one |
| SMILES | CCc1ccc2c(c1)CC(=O)N2CCCOc1cccc(N)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-14-7-8-18-15(11-14)12-19(22)21(18)9-4-10-23-17-6-3-5-16(20)13-17/h3,5-8,11,13H,2,4,9-10,12,20H2,1H3 |
| InChIKey | ZFZPDZJFTAGIFG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|