C12H18N2O3S — CID 43619907
3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propoxy]aniline (PubChem CID 43619907) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propoxy]aniline.
| Compound Name | 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propoxy]aniline |
|---|---|
| PubChem CID | 43619907 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propoxy]aniline |
| SMILES | Nc1cccc(OCCCN2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H18N2O3S/c13-11-4-1-5-12(10-11)17-8-2-6-14-7-3-9-18(14,15)16/h1,4-5,10H,2-3,6-9,13H2 |
| InChIKey | ZXLLYZLOAOPLNU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|