C14H21NO3S — CID 60522986
2-[3-(3,5-dimethylphenoxy)propyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 60522986) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenoxy)propyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[3-(3,5-dimethylphenoxy)propyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 60522986 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[3-(3,5-dimethylphenoxy)propyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | Cc1cc(C)cc(OCCCN2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-12-9-13(2)11-14(10-12)18-7-3-5-15-6-4-8-19(15,16)17/h9-11H,3-8H2,1-2H3 |
| InChIKey | FSSDMMLNTHECGB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|