C13H16FNO3 — CID 72940136
4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepan-5-one (PubChem CID 72940136) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 72940136 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepan-5-one |
| SMILES | O=C1CCOCCN1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO3/c14-11-1-3-12(4-2-11)18-10-7-15-6-9-17-8-5-13(15)16/h1-4H,5-10H2 |
| InChIKey | RPBXJUWZQRTWBY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |