C19H27FN2O3 — CID 45184997
1-[2-(4-fluorophenoxy)ethyl]-5-(3-hydroxypiperidin-1-yl)azepan-2-one (PubChem CID 45184997) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-5-(3-hydroxypiperidin-1-yl)azepan-2-one.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-5-(3-hydroxypiperidin-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 45184997 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-5-(3-hydroxypiperidin-1-yl)azepan-2-one |
| SMILES | O=C1CCC(N2CCCC(O)C2)CCN1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN2O3/c20-15-3-6-18(7-4-15)25-13-12-21-11-9-16(5-8-19(21)24)22-10-1-2-17(23)14-22/h3-4,6-7,16-17,23H,1-2,5,8-14H2 |
| InChIKey | CHIZAJRLCVAVBV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |