C18H25FN2O2 — CID 110123059
(5aS,9aR)-7-[2-(4-fluorophenoxy)ethyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 110123059) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is (5aS,9aR)-7-[2-(4-fluorophenoxy)ethyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-7-[2-(4-fluorophenoxy)ethyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 110123059 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (5aS,9aR)-7-[2-(4-fluorophenoxy)ethyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | CN1C(=O)CCC[C@H]2CN(CCOc3ccc(F)cc3)CC[C@H]21 |
| InChI | InChI=1S/C18H25FN2O2/c1-20-17-9-10-21(13-14(17)3-2-4-18(20)22)11-12-23-16-7-5-15(19)6-8-16/h5-8,14,17H,2-4,9-13H2,1H3/t14-,17+/m0/s1 |
| InChIKey | PCAVJVZCKGLDAS-WMLDXEAASA-N |
| XLogP | 2.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |