C6H5N5O3 — CID 172742817
5-nitro-N-(1,2,4-triazol-4-yl)-3H-furan-2-imine (PubChem CID 172742817) has the molecular formula C6H5N5O3 and a molecular weight of 195.14 g/mol. Its IUPAC name is 5-nitro-N-(1,2,4-triazol-4-yl)-3H-furan-2-imine.
| Compound Name | 5-nitro-N-(1,2,4-triazol-4-yl)-3H-furan-2-imine |
|---|---|
| PubChem CID | 172742817 |
| Molecular Formula | C6H5N5O3 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 5-nitro-N-(1,2,4-triazol-4-yl)-3H-furan-2-imine |
| SMILES | O=[N+]([O-])C1=CCC(=Nn2cnnc2)O1 |
| InChI | InChI=1S/C6H5N5O3/c12-11(13)6-2-1-5(14-6)9-10-3-7-8-4-10/h2-4H,1H2 |
| InChIKey | JIBRPWMCNASFRH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|