C2H4FeN5O3- — CID 89373178
iron;1,2,4-triazol-4-amine;nitrate (PubChem CID 89373178) has the molecular formula C2H4FeN5O3- and a molecular weight of 201.93 g/mol. Its IUPAC name is iron;1,2,4-triazol-4-amine;nitrate.
| Compound Name | iron;1,2,4-triazol-4-amine;nitrate |
|---|---|
| PubChem CID | 89373178 |
| Molecular Formula | C2H4FeN5O3- |
| Molecular Weight | 201.93 g/mol |
| Exact Mass | 201.97 |
| IUPAC Name | iron;1,2,4-triazol-4-amine;nitrate |
| SMILES | Nn1cnnc1.O=[N+]([O-])[O-].[Fe] |
| InChI | InChI=1S/C2H4N4.Fe.NO3/c3-6-1-4-5-2-6;;2-1(3)4/h1-2H,3H2;;/q;;-1 |
| InChIKey | IGAQBIAFIYGEQB-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.93 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|