C8H9N5O4 — CID 21390831
3-[(E)-(1-methyl-5-nitroimidazol-2-yl)methylideneamino]-1,3-oxazolidin-2-one (PubChem CID 21390831) has the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. Its IUPAC name is 3-[(E)-(1-methyl-5-nitroimidazol-2-yl)methylideneamino]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-(1-methyl-5-nitroimidazol-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 21390831 |
| Molecular Formula | C8H9N5O4 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-[(E)-(1-methyl-5-nitroimidazol-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
| SMILES | Cn1c([N+](=O)[O-])cnc1/C=N/N1CCOC1=O |
| InChI | InChI=1S/C8H9N5O4/c1-11-6(9-5-7(11)13(15)16)4-10-12-2-3-17-8(12)14/h4-5H,2-3H2,1H3/b10-4+ |
| InChIKey | RXMBPIHJAIRBBL-ONNFQVAWSA-N |
| XLogP | 0.11 |
| TPSA | 102.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|