C10H14N2 — CID 142336197
1,7-dihydroquinoxaline;ethane (PubChem CID 142336197) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,7-dihydroquinoxaline;ethane.
| Compound Name | 1,7-dihydroquinoxaline;ethane |
|---|---|
| PubChem CID | 142336197 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,7-dihydroquinoxaline;ethane |
| SMILES | C1=CC2=NC=CNC2=CC1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-4-8-7(3-1)9-5-6-10-8;1-2/h1,3-6,10H,2H2;1-2H3 |
| InChIKey | GSTBTNRFPUFVBD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |