C17H14Cl2N2 — CID 3435704
2-(dichloromethyl)-4-(4-methylphenyl)-1H-1,5-benzodiazepine (PubChem CID 3435704) has the molecular formula C17H14Cl2N2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(dichloromethyl)-4-(4-methylphenyl)-1H-1,5-benzodiazepine.
| Compound Name | 2-(dichloromethyl)-4-(4-methylphenyl)-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 3435704 |
| Molecular Formula | C17H14Cl2N2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(dichloromethyl)-4-(4-methylphenyl)-1H-1,5-benzodiazepine |
| SMILES | Cc1ccc(C2=Nc3ccccc3NC(C(Cl)Cl)=C2)cc1 |
| InChI | InChI=1S/C17H14Cl2N2/c1-11-6-8-12(9-7-11)15-10-16(17(18)19)21-14-5-3-2-4-13(14)20-15/h2-10,17,21H,1H3 |
| InChIKey | PSMDCHBPIDCVEJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|