C23H21N3 — CID 137314288
4-phenyl-N-(1-phenylethyl)-1,3-dihydro-1,5-benzodiazepin-2-imine (PubChem CID 137314288) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-phenyl-N-(1-phenylethyl)-1,3-dihydro-1,5-benzodiazepin-2-imine.
| Compound Name | 4-phenyl-N-(1-phenylethyl)-1,3-dihydro-1,5-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 137314288 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-phenyl-N-(1-phenylethyl)-1,3-dihydro-1,5-benzodiazepin-2-imine |
| SMILES | CC(/N=C1\CC(c2ccccc2)=Nc2ccccc2N1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3/c1-17(18-10-4-2-5-11-18)24-23-16-22(19-12-6-3-7-13-19)25-20-14-8-9-15-21(20)26-23/h2-15,17H,16H2,1H3,(H,24,26) |
| InChIKey | SIOYLPXCCXAEHZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|