C17H16N2O2S — CID 22762335
7,8-dimethoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione (PubChem CID 22762335) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 7,8-dimethoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione.
| Compound Name | 7,8-dimethoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 22762335 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 7,8-dimethoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione |
| SMILES | COc1cc2c(cc1OC)NC(=S)CC(c1ccccc1)=N2 |
| InChI | InChI=1S/C17H16N2O2S/c1-20-15-8-13-14(9-16(15)21-2)19-17(22)10-12(18-13)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | UEPRRLOBOXYJTN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|