C17H15N3 — CID 137190282
2,6-dimethyl-5,12-dihydroindolo[3,2-b][1,5]benzodiazepine (PubChem CID 137190282) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2,6-dimethyl-5,12-dihydroindolo[3,2-b][1,5]benzodiazepine.
| Compound Name | 2,6-dimethyl-5,12-dihydroindolo[3,2-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 137190282 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,6-dimethyl-5,12-dihydroindolo[3,2-b][1,5]benzodiazepine |
| SMILES | CC1=Nc2ccccc2Nc2c1[nH]c1ccc(C)cc21 |
| InChI | InChI=1S/C17H15N3/c1-10-7-8-13-12(9-10)17-16(19-13)11(2)18-14-5-3-4-6-15(14)20-17/h3-9,19-20H,1-2H3 |
| InChIKey | FISHQRHVQOKLTC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |