C20H14N2 — CID 150471805
14,22-diazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(15),2,4,6,8,10,12,16,18,20-decaene (PubChem CID 150471805) has the molecular formula C20H14N2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 14,22-diazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(15),2,4,6,8,10,12,16,18,20-decaene.
| Compound Name | 14,22-diazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(15),2,4,6,8,10,12,16,18,20-decaene |
|---|---|
| PubChem CID | 150471805 |
| Molecular Formula | C20H14N2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 14,22-diazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(15),2,4,6,8,10,12,16,18,20-decaene |
| SMILES | c1ccc2c(c1)Nc1c([nH]c3ccccc13)-c1ccccc1-2 |
| InChI | InChI=1S/C20H14N2/c1-2-9-15-13(7-1)14-8-3-5-11-17(14)21-20-16-10-4-6-12-18(16)22-19(15)20/h1-12,21-22H |
| InChIKey | HRYKADBLDMLNGB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |