C18H18N4 — CID 137182720
2-(7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-ylideneamino)ethanamine (PubChem CID 137182720) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-ylideneamino)ethanamine.
| Compound Name | 2-(7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-ylideneamino)ethanamine |
|---|---|
| PubChem CID | 137182720 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-ylideneamino)ethanamine |
| SMILES | NCC/N=C1\Cc2c([nH]c3ccccc23)-c2ccccc2N1 |
| InChI | InChI=1S/C18H18N4/c19-9-10-20-17-11-14-12-5-1-3-7-15(12)22-18(14)13-6-2-4-8-16(13)21-17/h1-8,22H,9-11,19H2,(H,20,21) |
| InChIKey | KUIUXVNRDBSZKM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|