C12H11N3O2 — CID 170859462
3,4,5,7-tetrahydro-1H-[1,5]diazocino[3,2-b]indole-2,6-dione (PubChem CID 170859462) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3,4,5,7-tetrahydro-1H-[1,5]diazocino[3,2-b]indole-2,6-dione.
| Compound Name | 3,4,5,7-tetrahydro-1H-[1,5]diazocino[3,2-b]indole-2,6-dione |
|---|---|
| PubChem CID | 170859462 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3,4,5,7-tetrahydro-1H-[1,5]diazocino[3,2-b]indole-2,6-dione |
| SMILES | O=C1CCNC(=O)c2[nH]c3ccccc3c2N1 |
| InChI | InChI=1S/C12H11N3O2/c16-9-5-6-13-12(17)11-10(15-9)7-3-1-2-4-8(7)14-11/h1-4,14H,5-6H2,(H,13,17)(H,15,16) |
| InChIKey | MJQZAYPAIGOQPQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |