C17H15N5O — CID 136657234
5-(pyridin-2-ylhydrazinylidene)-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one (PubChem CID 136657234) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 5-(pyridin-2-ylhydrazinylidene)-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one.
| Compound Name | 5-(pyridin-2-ylhydrazinylidene)-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 136657234 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(pyridin-2-ylhydrazinylidene)-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one |
| SMILES | O=C1NCCC(=NNc2ccccn2)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H15N5O/c23-17-16-15(11-5-1-2-6-12(11)20-16)13(8-10-19-17)21-22-14-7-3-4-9-18-14/h1-7,9,20H,8,10H2,(H,18,22)(H,19,23) |
| InChIKey | MGYTXFGAXIKJRJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|