C13H13N5O2 — CID 136501195
[(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)amino]urea (PubChem CID 136501195) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is [(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)amino]urea.
| Compound Name | [(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)amino]urea |
|---|---|
| PubChem CID | 136501195 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)amino]urea |
| SMILES | NC(=O)NN=C1CCNC(=O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C13H13N5O2/c14-13(20)18-17-9-5-6-15-12(19)11-10(9)7-3-1-2-4-8(7)16-11/h1-4,16H,5-6H2,(H,15,19)(H3,14,18,20) |
| InChIKey | KFZMBZKFCOVSHG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|