C20H17N3O2 — CID 144862097
5-[3-(1-methoxyethenyl)phenyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one (PubChem CID 144862097) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-[3-(1-methoxyethenyl)phenyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one.
| Compound Name | 5-[3-(1-methoxyethenyl)phenyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one |
|---|---|
| PubChem CID | 144862097 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-[3-(1-methoxyethenyl)phenyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one |
| SMILES | C=C(OC)c1cccc(C2=NCC(=O)Nc3c2[nH]c2ccccc32)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-12(25-2)13-6-5-7-14(10-13)18-20-19(23-17(24)11-21-18)15-8-3-4-9-16(15)22-20/h3-10,22H,1,11H2,2H3,(H,23,24) |
| InChIKey | SELYJUBMPDUEQX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|