C18H17N3O3 — CID 123857882
5-(3-methoxyphenyl)-1,2,3,6-tetrahydro-[1,4]diazepino[6,5-b]indole-2,3-diol (PubChem CID 123857882) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1,2,3,6-tetrahydro-[1,4]diazepino[6,5-b]indole-2,3-diol.
| Compound Name | 5-(3-methoxyphenyl)-1,2,3,6-tetrahydro-[1,4]diazepino[6,5-b]indole-2,3-diol |
|---|---|
| PubChem CID | 123857882 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-(3-methoxyphenyl)-1,2,3,6-tetrahydro-[1,4]diazepino[6,5-b]indole-2,3-diol |
| SMILES | COc1cccc(C2=NC(O)C(O)Nc3c2[nH]c2ccccc32)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-24-11-6-4-5-10(9-11)14-16-15(21-18(23)17(22)20-14)12-7-2-3-8-13(12)19-16/h2-9,17-19,21-23H,1H3 |
| InChIKey | PCSIWFOVIVRDGW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |