About 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole (PubChem CID 11430193) has the molecular formula C29H32N2O
and a molecular weight of 424.59 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole.
Molecular Properties
| Compound Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole |
| PubChem CID | 11430193 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole |
| SMILES | COc1cccc(-c2[nH]c3ccccc3c2CN2CCC(c3c(C)cccc3C)CC2)c1 |
| InChI | InChI=1S/C29H32N2O/c1-20-8-6-9-21(2)28(20)22-14-16-31(17-15-22)19-26-25-12-4-5-13-27(25)30-29(26)23-10-7-11-24(18-23)32-3/h4-13,18,22,30H,14-17,19H2,1-3H3 |
| InChIKey | DGYCIZJIBMCPPE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole?
The IUPAC name of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole (CID 11430193) is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole.
What is the SMILES notation for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole?
The canonical SMILES for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole is COc1cccc(-c2[nH]c3ccccc3c2CN2CCC(c3c(C)cccc3C)CC2)c1.
What is the InChIKey of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole?
The InChIKey is DGYCIZJIBMCPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32N2O/c1-20-8-6-9-21(2)28(20)22-14-16-31(17-15-22)19-26-25-12-4-5-13-27(25)30-29(26)23-10-7-11-24(18-23)32-3/h4-13,18,22,30H,14-17,19H2,1-3H3.
What are the key properties of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole?
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole has a molecular weight of 424.59 g/mol, XLogP of 6.84, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-(3-methoxyphenyl)-1H-indole is sourced from PubChem (CID 11430193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).