C29H35N3O — CID 69076323
7-azabicyclo[2.2.1]heptan-7-yl-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]methanone (PubChem CID 69076323) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is 7-azabicyclo[2.2.1]heptan-7-yl-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]methanone.
| Compound Name | 7-azabicyclo[2.2.1]heptan-7-yl-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 69076323 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 7-azabicyclo[2.2.1]heptan-7-yl-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]methanone |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(C(=O)N3C4CCC3CC4)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C29H35N3O/c1-19-6-5-7-20(2)27(19)21-14-16-31(17-15-21)18-25-24-8-3-4-9-26(24)30-28(25)29(33)32-22-10-11-23(32)13-12-22/h3-9,21-23,30H,10-18H2,1-2H3 |
| InChIKey | XZHCZUMHRNVWLA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|