C33H38N4O2 — CID 69074498
[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone (PubChem CID 69074498) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is [3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69074498 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indol-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(C(=O)N3CCN(c4ccc(O)cc4)CC3)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C33H38N4O2/c1-23-6-5-7-24(2)31(23)25-14-16-35(17-15-25)22-29-28-8-3-4-9-30(28)34-32(29)33(39)37-20-18-36(19-21-37)26-10-12-27(38)13-11-26/h3-13,25,34,38H,14-22H2,1-2H3 |
| InChIKey | TXLSXRAMNHAJAD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|