C23H26N2O — CID 140542086
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbaldehyde (PubChem CID 140542086) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbaldehyde.
| Compound Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 140542086 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbaldehyde |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(C=O)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C23H26N2O/c1-16-6-5-7-17(2)23(16)18-10-12-25(13-11-18)14-20-19-8-3-4-9-21(19)24-22(20)15-26/h3-9,15,18,24H,10-14H2,1-2H3 |
| InChIKey | GPXQRDMQQQZCBB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|