C29H36N4O2 — CID 69080494
1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperidine-4-carboxamide (PubChem CID 69080494) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 69080494 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(C(=O)N3CCC(C(N)=O)CC3)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C29H36N4O2/c1-19-6-5-7-20(2)26(19)21-10-14-32(15-11-21)18-24-23-8-3-4-9-25(23)31-27(24)29(35)33-16-12-22(13-17-33)28(30)34/h3-9,21-22,31H,10-18H2,1-2H3,(H2,30,34) |
| InChIKey | JBWQNTPFECEZQQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|