C32H32Cl2N4O2 — CID 69075099
[4-[3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperazin-1-yl]-phenylmethanone (PubChem CID 69075099) has the molecular formula C32H32Cl2N4O2 and a molecular weight of 575.54 g/mol. Its IUPAC name is [4-[3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 69075099 |
| Molecular Formula | C32H32Cl2N4O2 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [4-[3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2[nH]c3ccccc3c2CN2CCC(c3c(Cl)cccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C32H32Cl2N4O2/c33-26-10-6-11-27(34)29(26)22-13-15-36(16-14-22)21-25-24-9-4-5-12-28(24)35-30(25)32(40)38-19-17-37(18-20-38)31(39)23-7-2-1-3-8-23/h1-12,22,35H,13-21H2 |
| InChIKey | CJDLJJKSKARZQS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|