C25H31N3O — CID 11620349
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-N,N-dimethyl-1H-indole-2-carboxamide (PubChem CID 11620349) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-N,N-dimethyl-1H-indole-2-carboxamide.
| Compound Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-N,N-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11620349 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-N,N-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(C(=O)N(C)C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H31N3O/c1-17-8-7-9-18(2)23(17)19-12-14-28(15-13-19)16-21-20-10-5-6-11-22(20)26-24(21)25(29)27(3)4/h5-11,19,26H,12-16H2,1-4H3 |
| InChIKey | SWMWBJFFOXDDFU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|