C33H44N4O2 — CID 69074966
1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 69074966) has the molecular formula C33H44N4O2 and a molecular weight of 528.74 g/mol. Its IUPAC name is 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 69074966 |
| Molecular Formula | C33H44N4O2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 1-[3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-1H-indole-2-carbonyl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)c2[nH]c3ccccc3c2CN2CCC(c3c(C)cccc3C)CC2)C1 |
| InChI | InChI=1S/C33H44N4O2/c1-5-36(6-2)32(38)26-13-10-18-37(21-26)33(39)31-28(27-14-7-8-15-29(27)34-31)22-35-19-16-25(17-20-35)30-23(3)11-9-12-24(30)4/h7-9,11-12,14-15,25-26,34H,5-6,10,13,16-22H2,1-4H3 |
| InChIKey | HUUWOQQMNMRJCL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|