C18H17N3O — CID 144862136
5-[(2Z)-2-ethenylpenta-2,4-dienyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one (PubChem CID 144862136) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one.
| Compound Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one |
|---|---|
| PubChem CID | 144862136 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-2-one |
| SMILES | C=C/C=C(\C=C)CC1=NCC(=O)Nc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H17N3O/c1-3-7-12(4-2)10-15-18-17(21-16(22)11-19-15)13-8-5-6-9-14(13)20-18/h3-9,20H,1-2,10-11H2,(H,21,22)/b12-7+ |
| InChIKey | LBAHIOMDMRCTKZ-KPKJPENVSA-N |
| XLogP | 3.60 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|