C15H11NO — CID 71552409
5,10-dihydroindeno[1,2-b]indol-10-ol (PubChem CID 71552409) has the molecular formula C15H11NO and a molecular weight of 221.26 g/mol. Its IUPAC name is 5,10-dihydroindeno[1,2-b]indol-10-ol.
| Compound Name | 5,10-dihydroindeno[1,2-b]indol-10-ol |
|---|---|
| PubChem CID | 71552409 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5,10-dihydroindeno[1,2-b]indol-10-ol |
| SMILES | OC1c2ccccc2-c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C15H11NO/c17-15-10-6-2-1-5-9(10)14-13(15)11-7-3-4-8-12(11)16-14/h1-8,15-17H |
| InChIKey | PEOUCIDRFMJDJN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |