C16H13NO — CID 15133177
10-methoxy-5,10-dihydroindeno[1,2-b]indole (PubChem CID 15133177) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is 10-methoxy-5,10-dihydroindeno[1,2-b]indole.
| Compound Name | 10-methoxy-5,10-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 15133177 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 10-methoxy-5,10-dihydroindeno[1,2-b]indole |
| SMILES | COC1c2ccccc2-c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C16H13NO/c1-18-16-11-7-3-2-6-10(11)15-14(16)12-8-4-5-9-13(12)17-15/h2-9,16-17H,1H3 |
| InChIKey | KNVWNAANPFCFQZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |