C18H15NO2 — CID 135022384
(3Z)-3-benzylidene-1-methoxy-1,4-dihydrofuro[3,4-b]indole (PubChem CID 135022384) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3Z)-3-benzylidene-1-methoxy-1,4-dihydrofuro[3,4-b]indole.
| Compound Name | (3Z)-3-benzylidene-1-methoxy-1,4-dihydrofuro[3,4-b]indole |
|---|---|
| PubChem CID | 135022384 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3Z)-3-benzylidene-1-methoxy-1,4-dihydrofuro[3,4-b]indole |
| SMILES | COC1O/C(=C\c2ccccc2)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C18H15NO2/c1-20-18-16-13-9-5-6-10-14(13)19-17(16)15(21-18)11-12-7-3-2-4-8-12/h2-11,18-19H,1H3/b15-11- |
| InChIKey | OUPXVDHSGOAGPV-PTNGSMBKSA-N |
| XLogP | 4.34 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |