C29H24N2O — CID 164680804
(1S)-2-methyl-1,4,4-triphenyl-1,5-dihydrooxazino[5,4-b]indole (PubChem CID 164680804) has the molecular formula C29H24N2O and a molecular weight of 416.52 g/mol. Its IUPAC name is (1S)-2-methyl-1,4,4-triphenyl-1,5-dihydrooxazino[5,4-b]indole.
| Compound Name | (1S)-2-methyl-1,4,4-triphenyl-1,5-dihydrooxazino[5,4-b]indole |
|---|---|
| PubChem CID | 164680804 |
| Molecular Formula | C29H24N2O |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (1S)-2-methyl-1,4,4-triphenyl-1,5-dihydrooxazino[5,4-b]indole |
| SMILES | CN1OC(c2ccccc2)(c2ccccc2)c2[nH]c3ccccc3c2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H24N2O/c1-31-27(21-13-5-2-6-14-21)26-24-19-11-12-20-25(24)30-28(26)29(32-31,22-15-7-3-8-16-22)23-17-9-4-10-18-23/h2-20,27,30H,1H3/t27-/m0/s1 |
| InChIKey | ARQAFIHTFKJLTA-MHZLTWQESA-N |
| XLogP | 6.43 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |