C24H26N2O — CID 2554408
(1S,4S)-5',5'-dimethyl-4-phenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-cyclohexane]-1'-one (PubChem CID 2554408) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is (1S,4S)-5',5'-dimethyl-4-phenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-cyclohexane]-1'-one.
| Compound Name | (1S,4S)-5',5'-dimethyl-4-phenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 2554408 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (1S,4S)-5',5'-dimethyl-4-phenylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-cyclohexane]-1'-one |
| SMILES | CC1(C)CC(=O)C[C@]2(C1)NC[C@@H](c1ccccc1)c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C24H26N2O/c1-23(2)12-17(27)13-24(15-23)22-21(18-10-6-7-11-20(18)26-22)19(14-25-24)16-8-4-3-5-9-16/h3-11,19,25-26H,12-15H2,1-2H3/t19-,24+/m0/s1 |
| InChIKey | RDUOSIUGTZVTHR-YADARESESA-N |
| XLogP | 4.88 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |