C23H26N2O2 — CID 4851787
4-(2,3-dimethoxyphenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclopentane] (PubChem CID 4851787) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclopentane].
| Compound Name | 4-(2,3-dimethoxyphenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclopentane] |
|---|---|
| PubChem CID | 4851787 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclopentane] |
| SMILES | COc1cccc(C2CNC3(CCCC3)c3[nH]c4ccccc4c32)c1OC |
| InChI | InChI=1S/C23H26N2O2/c1-26-19-11-7-9-15(21(19)27-2)17-14-24-23(12-5-6-13-23)22-20(17)16-8-3-4-10-18(16)25-22/h3-4,7-11,17,24-25H,5-6,12-14H2,1-2H3 |
| InChIKey | WEOGMGPWXZEBBC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |