C24H26ClN2O+ — CID 2110993
(1S,4R)-4-(2-chlorophenyl)-5',5'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,3'-cyclohexane]-1'-one (PubChem CID 2110993) has the molecular formula C24H26ClN2O+ and a molecular weight of 393.94 g/mol. Its IUPAC name is (1S,4R)-4-(2-chlorophenyl)-5',5'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,3'-cyclohexane]-1'-one.
| Compound Name | (1S,4R)-4-(2-chlorophenyl)-5',5'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,3'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 2110993 |
| Molecular Formula | C24H26ClN2O+ |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (1S,4R)-4-(2-chlorophenyl)-5',5'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium-1,3'-cyclohexane]-1'-one |
| SMILES | CC1(C)CC(=O)C[C@]2(C1)[NH2+]C[C@@H](c1ccccc1Cl)c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25ClN2O/c1-23(2)11-15(28)12-24(14-23)22-21(17-8-4-6-10-20(17)27-22)18(13-26-24)16-7-3-5-9-19(16)25/h3-10,18,26-27H,11-14H2,1-2H3/p+1/t18-,24+/m0/s1 |
| InChIKey | YDXXMDROEYQMOS-MHECFPHRSA-O |
| XLogP | 4.50 |
| TPSA | 49.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |