C28H24ClN3O2 — CID 40824069
(2S,8R)-4-(2-chlorophenyl)-8-(4-ethylphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione (PubChem CID 40824069) has the molecular formula C28H24ClN3O2 and a molecular weight of 469.97 g/mol. Its IUPAC name is (2S,8R)-4-(2-chlorophenyl)-8-(4-ethylphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione.
| Compound Name | (2S,8R)-4-(2-chlorophenyl)-8-(4-ethylphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione |
|---|---|
| PubChem CID | 40824069 |
| Molecular Formula | C28H24ClN3O2 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (2S,8R)-4-(2-chlorophenyl)-8-(4-ethylphenyl)-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene-3,5-dione |
| SMILES | CCc1ccc([C@H]2CN3C(=O)N(c4ccccc4Cl)C(=O)[C@]3(C)c3[nH]c4ccccc4c32)cc1 |
| InChI | InChI=1S/C28H24ClN3O2/c1-3-17-12-14-18(15-13-17)20-16-31-27(34)32(23-11-7-5-9-21(23)29)26(33)28(31,2)25-24(20)19-8-4-6-10-22(19)30-25/h4-15,20,30H,3,16H2,1-2H3/t20-,28+/m1/s1 |
| InChIKey | ZWEFIDAVWUMVRN-NGOKVRLYSA-N |
| XLogP | 6.21 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|