C30H37N3O3 — CID 6573032
(2S,9R)-4-(3-butoxypropyl)-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 6573032) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is (2S,9R)-4-(3-butoxypropyl)-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2S,9R)-4-(3-butoxypropyl)-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 6573032 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (2S,9R)-4-(3-butoxypropyl)-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | CCCCOCCCN1CC(=O)N2C[C@H](c3ccc(CC)cc3)c3c([nH]c4ccccc34)[C@@]2(C)C1=O |
| InChI | InChI=1S/C30H37N3O3/c1-4-6-17-36-18-9-16-32-20-26(34)33-19-24(22-14-12-21(5-2)13-15-22)27-23-10-7-8-11-25(23)31-28(27)30(33,3)29(32)35/h7-8,10-15,24,31H,4-6,9,16-20H2,1-3H3/t24-,30+/m1/s1 |
| InChIKey | LABLJNZYLBKZHT-HLADLETHSA-N |
| XLogP | 4.97 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|