C30H28ClN3O2 — CID 4835537
4-[(3-chlorophenyl)methyl]-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 4835537) has the molecular formula C30H28ClN3O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | 4-[(3-chlorophenyl)methyl]-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 4835537 |
| Molecular Formula | C30H28ClN3O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-9-(4-ethylphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | CCc1ccc(C2CN3C(=O)CN(Cc4cccc(Cl)c4)C(=O)C3(C)c3[nH]c4ccccc4c32)cc1 |
| InChI | InChI=1S/C30H28ClN3O2/c1-3-19-11-13-21(14-12-19)24-17-34-26(35)18-33(16-20-7-6-8-22(31)15-20)29(36)30(34,2)28-27(24)23-9-4-5-10-25(23)32-28/h4-15,24,32H,3,16-18H2,1-2H3 |
| InChIKey | QQLFQETTZWMJNH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |