C28H23ClFN3O2 — CID 6573260
(2S,9S)-9-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 6573260) has the molecular formula C28H23ClFN3O2 and a molecular weight of 487.96 g/mol. Its IUPAC name is (2S,9S)-9-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2S,9S)-9-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 6573260 |
| Molecular Formula | C28H23ClFN3O2 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (2S,9S)-9-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | C[C@]12C(=O)N(Cc3ccc(F)cc3)CC(=O)N1C[C@@H](c1ccc(Cl)cc1)c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C28H23ClFN3O2/c1-28-26-25(21-4-2-3-5-23(21)31-26)22(18-8-10-19(29)11-9-18)15-33(28)24(34)16-32(27(28)35)14-17-6-12-20(30)13-7-17/h2-13,22,31H,14-16H2,1H3/t22-,28-/m0/s1 |
| InChIKey | QKMPUTZMPRIDII-DWACAAAGSA-N |
| XLogP | 5.19 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |