C29H26BrN3O3 — CID 95372265
(2S,9R)-9-(4-bromophenyl)-4-[(3-methoxyphenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 95372265) has the molecular formula C29H26BrN3O3 and a molecular weight of 544.45 g/mol. Its IUPAC name is (2S,9R)-9-(4-bromophenyl)-4-[(3-methoxyphenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2S,9R)-9-(4-bromophenyl)-4-[(3-methoxyphenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 95372265 |
| Molecular Formula | C29H26BrN3O3 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | (2S,9R)-9-(4-bromophenyl)-4-[(3-methoxyphenyl)methyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | COc1cccc(CN2CC(=O)N3C[C@H](c4ccc(Br)cc4)c4c([nH]c5ccccc45)[C@@]3(C)C2=O)c1 |
| InChI | InChI=1S/C29H26BrN3O3/c1-29-27-26(22-8-3-4-9-24(22)31-27)23(19-10-12-20(30)13-11-19)16-33(29)25(34)17-32(28(29)35)15-18-6-5-7-21(14-18)36-2/h3-14,23,31H,15-17H2,1-2H3/t23-,29+/m1/s1 |
| InChIKey | JRDKAMKOQYDRNH-BTYSJIOQSA-N |
| XLogP | 5.17 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |