C30H28ClN3O3 — CID 4835173
4-[2-(4-chlorophenyl)ethyl]-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 4835173) has the molecular formula C30H28ClN3O3 and a molecular weight of 514.03 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethyl]-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | 4-[2-(4-chlorophenyl)ethyl]-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 4835173 |
| Molecular Formula | C30H28ClN3O3 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethyl]-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | COc1ccccc1C1CN2C(=O)CN(CCc3ccc(Cl)cc3)C(=O)C2(C)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C30H28ClN3O3/c1-30-28-27(22-8-3-5-9-24(22)32-28)23(21-7-4-6-10-25(21)37-2)17-34(30)26(35)18-33(29(30)36)16-15-19-11-13-20(31)14-12-19/h3-14,23,32H,15-18H2,1-2H3 |
| InChIKey | RAHMBKLIVRSOOK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |