C30H29N3O4 — CID 4836115
4-(2-hydroxy-2-phenylethyl)-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 4836115) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 4-(2-hydroxy-2-phenylethyl)-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | 4-(2-hydroxy-2-phenylethyl)-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 4836115 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-(2-hydroxy-2-phenylethyl)-9-(2-methoxyphenyl)-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | COc1ccccc1C1CN2C(=O)CN(CC(O)c3ccccc3)C(=O)C2(C)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C30H29N3O4/c1-30-28-27(21-13-6-8-14-23(21)31-28)22(20-12-7-9-15-25(20)37-2)16-33(30)26(35)18-32(29(30)36)17-24(34)19-10-4-3-5-11-19/h3-15,22,24,31,34H,16-18H2,1-2H3 |
| InChIKey | IICKFLILYGIDHP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |